About 2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine
2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine (PubChem CID 70227629) has the molecular formula C7H9Cl2N2O2PS
and a molecular weight of 287.11 g/mol. Its IUPAC name is 2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine.
Molecular Properties
| Compound Name | 2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine |
| PubChem CID | 70227629 |
| Molecular Formula | C7H9Cl2N2O2PS |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 285.95 |
| IUPAC Name | 2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine |
| SMILES | CCOP(N)(=S)Oc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C7H9Cl2N2O2PS/c1-2-12-14(10,15)13-7-6(9)3-5(8)4-11-7/h3-4H,2H2,1H3,(H2,10,15) |
| InChIKey | BXSOBFDGEVBCRR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine?
The IUPAC name of 2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine (CID 70227629) is 2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine.
What is the SMILES notation for 2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine?
The canonical SMILES for 2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine is CCOP(N)(=S)Oc1ncc(Cl)cc1Cl.
What is the InChIKey of 2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine?
The InChIKey is BXSOBFDGEVBCRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl2N2O2PS/c1-2-12-14(10,15)13-7-6(9)3-5(8)4-11-7/h3-4H,2H2,1H3,(H2,10,15).
What are the key properties of 2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine?
2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine has a molecular weight of 287.11 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[amino(ethoxy)phosphinothioyl]oxy-3,5-dichloropyridine is sourced from PubChem (CID 70227629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).