About ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate
ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate (PubChem CID 70227904) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate |
| PubChem CID | 70227904 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate |
| SMILES | CCOC(=O)C1C=CCC(C)(CC(C)O)N1C |
| InChI | InChI=1S/C13H23NO3/c1-5-17-12(16)11-7-6-8-13(3,14(11)4)9-10(2)15/h6-7,10-11,15H,5,8-9H2,1-4H3 |
| InChIKey | KMIORRISRQROCT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate?
The IUPAC name of ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate (CID 70227904) is ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate.
What is the SMILES notation for ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate?
The canonical SMILES for ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate is CCOC(=O)C1C=CCC(C)(CC(C)O)N1C.
What is the InChIKey of ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate?
The InChIKey is KMIORRISRQROCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO3/c1-5-17-12(16)11-7-6-8-13(3,14(11)4)9-10(2)15/h6-7,10-11,15H,5,8-9H2,1-4H3.
What are the key properties of ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate?
ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate has a molecular weight of 241.33 g/mol, XLogP of 1.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-(2-hydroxypropyl)-1,6-dimethyl-2,5-dihydropyridine-2-carboxylate is sourced from PubChem (CID 70227904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).