About N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide
N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide (PubChem CID 70227914) has the molecular formula C12H14N4O
and a molecular weight of 230.27 g/mol. Its IUPAC name is N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide.
Molecular Properties
| Compound Name | N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide |
| PubChem CID | 70227914 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cnc2c(c1)CCC=C2 |
| InChI | InChI=1S/C12H14N4O/c1-14-12(13)16-11(17)9-6-8-4-2-3-5-10(8)15-7-9/h3,5-7H,2,4H2,1H3,(H3,13,14,16,17) |
| InChIKey | QZOFPYSXBXLQAH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide?
The IUPAC name of N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide (CID 70227914) is N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide.
What is the SMILES notation for N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide?
The canonical SMILES for N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide is C/N=C(\N)NC(=O)c1cnc2c(c1)CCC=C2.
What is the InChIKey of N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide?
The InChIKey is QZOFPYSXBXLQAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O/c1-14-12(13)16-11(17)9-6-8-4-2-3-5-10(8)15-7-9/h3,5-7H,2,4H2,1H3,(H3,13,14,16,17).
What are the key properties of N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide?
N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide has a molecular weight of 230.27 g/mol, XLogP of 0.72, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(N'-methylcarbamimidoyl)-5,6-dihydroquinoline-3-carboxamide is sourced from PubChem (CID 70227914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).