About 2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine
2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine (PubChem CID 70228013) has the molecular formula C16H12BrFN2O2
and a molecular weight of 363.19 g/mol. Its IUPAC name is 2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine.
Molecular Properties
| Compound Name | 2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
| PubChem CID | 70228013 |
| Molecular Formula | C16H12BrFN2O2 |
| Molecular Weight | 363.19 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine |
| SMILES | Cc1ccc2c(c1)C1(COC(N)=N1)c1cc(Br)cc(F)c1O2 |
| InChI | InChI=1S/C16H12BrFN2O2/c1-8-2-3-13-10(4-8)16(7-21-15(19)20-16)11-5-9(17)6-12(18)14(11)22-13/h2-6H,7H2,1H3,(H2,19,20) |
| InChIKey | WVZDYNZPCVTSJC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine?
The IUPAC name of 2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine (CID 70228013) is 2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine.
What is the SMILES notation for 2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine?
The canonical SMILES for 2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine is Cc1ccc2c(c1)C1(COC(N)=N1)c1cc(Br)cc(F)c1O2.
What is the InChIKey of 2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine?
The InChIKey is WVZDYNZPCVTSJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrFN2O2/c1-8-2-3-13-10(4-8)16(7-21-15(19)20-16)11-5-9(17)6-12(18)14(11)22-13/h2-6H,7H2,1H3,(H2,19,20).
What are the key properties of 2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine?
2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine has a molecular weight of 363.19 g/mol, XLogP of 3.59, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-bromo-4'-fluoro-7'-methylspiro[5H-1,3-oxazole-4,9'-xanthene]-2-amine is sourced from PubChem (CID 70228013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).