About 2H-chromene;1,1,2,2-tetrafluoroethene
2H-chromene;1,1,2,2-tetrafluoroethene (PubChem CID 70228304) has the molecular formula C11H8F4O
and a molecular weight of 232.18 g/mol. Its IUPAC name is 2H-chromene;1,1,2,2-tetrafluoroethene.
Molecular Properties
| Compound Name | 2H-chromene;1,1,2,2-tetrafluoroethene |
| PubChem CID | 70228304 |
| Molecular Formula | C11H8F4O |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2H-chromene;1,1,2,2-tetrafluoroethene |
| SMILES | C1=Cc2ccccc2OC1.FC(F)=C(F)F |
| InChI | InChI=1S/C9H8O.C2F4/c1-2-6-9-8(4-1)5-3-7-10-9;3-1(4)2(5)6/h1-6H,7H2; |
| InChIKey | MVQNTFIPZKPPHU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-chromene;1,1,2,2-tetrafluoroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-chromene;1,1,2,2-tetrafluoroethene?
The IUPAC name of 2H-chromene;1,1,2,2-tetrafluoroethene (CID 70228304) is 2H-chromene;1,1,2,2-tetrafluoroethene.
What is the SMILES notation for 2H-chromene;1,1,2,2-tetrafluoroethene?
The canonical SMILES for 2H-chromene;1,1,2,2-tetrafluoroethene is C1=Cc2ccccc2OC1.FC(F)=C(F)F.
What is the InChIKey of 2H-chromene;1,1,2,2-tetrafluoroethene?
The InChIKey is MVQNTFIPZKPPHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.C2F4/c1-2-6-9-8(4-1)5-3-7-10-9;3-1(4)2(5)6/h1-6H,7H2;.
What are the key properties of 2H-chromene;1,1,2,2-tetrafluoroethene?
2H-chromene;1,1,2,2-tetrafluoroethene has a molecular weight of 232.18 g/mol, XLogP of 4.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-chromene;1,1,2,2-tetrafluoroethene is sourced from PubChem (CID 70228304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).