C25H30N6O3 — CID 70228472
3-[6-(2-ethoxyethylamino)-11-[(4-methylpiperazin-1-yl)methyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]phenol (PubChem CID 70228472) has the molecular formula C25H30N6O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is 3-[6-(2-ethoxyethylamino)-11-[(4-methylpiperazin-1-yl)methyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]phenol.
| Compound Name | 3-[6-(2-ethoxyethylamino)-11-[(4-methylpiperazin-1-yl)methyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]phenol |
|---|---|
| PubChem CID | 70228472 |
| Molecular Formula | C25H30N6O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 3-[6-(2-ethoxyethylamino)-11-[(4-methylpiperazin-1-yl)methyl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]phenol |
| SMILES | CCOCCNc1nc(-c2cccc(O)c2)nc2c1oc1nc(CN3CCN(C)CC3)ccc12 |
| InChI | InChI=1S/C25H30N6O3/c1-3-33-14-9-26-24-22-21(28-23(29-24)17-5-4-6-19(32)15-17)20-8-7-18(27-25(20)34-22)16-31-12-10-30(2)11-13-31/h4-8,15,32H,3,9-14,16H2,1-2H3,(H,26,28,29) |
| InChIKey | QNECTABUUFWUKR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|