C12H11Cl3N2O4 — CID 70228483
(2R,3S,4R)-2-(hydroxymethyl)-5-(2,6,7-trichloroimidazo[1,2-a]pyridin-3-yl)oxolane-3,4-diol (PubChem CID 70228483) has the molecular formula C12H11Cl3N2O4 and a molecular weight of 353.59 g/mol. Its IUPAC name is (2R,3S,4R)-2-(hydroxymethyl)-5-(2,6,7-trichloroimidazo[1,2-a]pyridin-3-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R)-2-(hydroxymethyl)-5-(2,6,7-trichloroimidazo[1,2-a]pyridin-3-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70228483 |
| Molecular Formula | C12H11Cl3N2O4 |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | (2R,3S,4R)-2-(hydroxymethyl)-5-(2,6,7-trichloroimidazo[1,2-a]pyridin-3-yl)oxolane-3,4-diol |
| SMILES | OC[C@H]1OC(c2c(Cl)nc3cc(Cl)c(Cl)cn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H11Cl3N2O4/c13-4-1-7-16-12(15)8(17(7)2-5(4)14)11-10(20)9(19)6(3-18)21-11/h1-2,6,9-11,18-20H,3H2/t6-,9-,10-,11?/m1/s1 |
| InChIKey | JVQIIUVXTMSHEE-SLHBNPHZSA-N |
| XLogP | 1.45 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |