C15H20BN7O2 — CID 70229089
5-(4,6-dimorpholin-4-yl-1,3,5-diazaborinin-2-yl)pyrimidin-2-amine (PubChem CID 70229089) has the molecular formula C15H20BN7O2 and a molecular weight of 341.18 g/mol. Its IUPAC name is 5-(4,6-dimorpholin-4-yl-1,3,5-diazaborinin-2-yl)pyrimidin-2-amine.
| Compound Name | 5-(4,6-dimorpholin-4-yl-1,3,5-diazaborinin-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 70229089 |
| Molecular Formula | C15H20BN7O2 |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 5-(4,6-dimorpholin-4-yl-1,3,5-diazaborinin-2-yl)pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)bc(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C15H20BN7O2/c17-15-18-9-11(10-19-15)12-20-13(22-1-5-24-6-2-22)16-14(21-12)23-3-7-25-8-4-23/h9-10H,1-8H2,(H2,17,18,19) |
| InChIKey | XRWNMDGPXGXYAR-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |