About 2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine
2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine (PubChem CID 70229370) has the molecular formula C12H21F2NO
and a molecular weight of 233.30 g/mol. Its IUPAC name is 2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine.
Molecular Properties
| Compound Name | 2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine |
| PubChem CID | 70229370 |
| Molecular Formula | C12H21F2NO |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine |
| SMILES | FC1(F)CNC(COCC2CCCCC2)C1 |
| InChI | InChI=1S/C12H21F2NO/c13-12(14)6-11(15-9-12)8-16-7-10-4-2-1-3-5-10/h10-11,15H,1-9H2 |
| InChIKey | XPAMBVQPBLKFGK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine?
The IUPAC name of 2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine (CID 70229370) is 2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine.
What is the SMILES notation for 2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine?
The canonical SMILES for 2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine is FC1(F)CNC(COCC2CCCCC2)C1.
What is the InChIKey of 2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine?
The InChIKey is XPAMBVQPBLKFGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO/c13-12(14)6-11(15-9-12)8-16-7-10-4-2-1-3-5-10/h10-11,15H,1-9H2.
What are the key properties of 2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine?
2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine has a molecular weight of 233.30 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylmethoxymethyl)-4,4-difluoropyrrolidine is sourced from PubChem (CID 70229370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).