C15H20O7 — CID 70230107
prop-2-enyl 6-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-6-hydroxyhexanoate (PubChem CID 70230107) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is prop-2-enyl 6-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-6-hydroxyhexanoate.
| Compound Name | prop-2-enyl 6-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-6-hydroxyhexanoate |
|---|---|
| PubChem CID | 70230107 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | prop-2-enyl 6-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-6-hydroxyhexanoate |
| SMILES | C=CCOC(=O)CCCCC(O)=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C15H20O7/c1-4-9-20-11(17)8-6-5-7-10(16)12-13(18)21-15(2,3)22-14(12)19/h4,16H,1,5-9H2,2-3H3 |
| InChIKey | AUZNKXCVOQPHGX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|