About 3-chloro-2,6-dimethylaniline
3-chloro-2,6-dimethylaniline (PubChem CID 7023016) has the molecular formula C8H10ClN
and a molecular weight of 155.63 g/mol. Its IUPAC name is 3-chloro-2,6-dimethylaniline.
Molecular Properties
| Compound Name | 3-chloro-2,6-dimethylaniline |
| PubChem CID | 7023016 |
| Molecular Formula | C8H10ClN |
| Molecular Weight | 155.63 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 3-chloro-2,6-dimethylaniline |
| SMILES | Cc1ccc(Cl)c(C)c1N |
| InChI | InChI=1S/C8H10ClN/c1-5-3-4-7(9)6(2)8(5)10/h3-4H,10H2,1-2H3 |
| InChIKey | FGMXFOTYCHZCLA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.63 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,6-dimethylaniline?
The IUPAC name of 3-chloro-2,6-dimethylaniline (CID 7023016) is 3-chloro-2,6-dimethylaniline.
What is the SMILES notation for 3-chloro-2,6-dimethylaniline?
The canonical SMILES for 3-chloro-2,6-dimethylaniline is Cc1ccc(Cl)c(C)c1N.
What is the InChIKey of 3-chloro-2,6-dimethylaniline?
The InChIKey is FGMXFOTYCHZCLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN/c1-5-3-4-7(9)6(2)8(5)10/h3-4H,10H2,1-2H3.
What are the key properties of 3-chloro-2,6-dimethylaniline?
3-chloro-2,6-dimethylaniline has a molecular weight of 155.63 g/mol, XLogP of 2.54, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,6-dimethylaniline is sourced from PubChem (CID 7023016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).