C7H14Cl2N2 — CID 70230192
(7aR)-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine;dihydrochloride (PubChem CID 70230192) has the molecular formula C7H14Cl2N2 and a molecular weight of 197.11 g/mol. Its IUPAC name is (7aR)-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine;dihydrochloride.
| Compound Name | (7aR)-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 70230192 |
| Molecular Formula | C7H14Cl2N2 |
| Molecular Weight | 197.11 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (7aR)-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine;dihydrochloride |
| SMILES | C1=C2CNC[C@@H]2NCC1.Cl.Cl |
| InChI | InChI=1S/C7H12N2.2ClH/c1-2-6-4-8-5-7(6)9-3-1;;/h2,7-9H,1,3-5H2;2*1H/t7-;;/m0../s1 |
| InChIKey | VDAXTGIPFPUSLK-KLXURFKVSA-N |
| XLogP | 0.72 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.11 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|