C17H24O3 — CID 70230200
1-(4-methoxyphenyl)-8-methylnonane-1,7-dione (PubChem CID 70230200) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-8-methylnonane-1,7-dione.
| Compound Name | 1-(4-methoxyphenyl)-8-methylnonane-1,7-dione |
|---|---|
| PubChem CID | 70230200 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 1-(4-methoxyphenyl)-8-methylnonane-1,7-dione |
| SMILES | COc1ccc(C(=O)CCCCCC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C17H24O3/c1-13(2)16(18)7-5-4-6-8-17(19)14-9-11-15(20-3)12-10-14/h9-13H,4-8H2,1-3H3 |
| InChIKey | OFIFJONFTFXWSO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|