About (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid
(2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid (PubChem CID 70230436) has the molecular formula C19H19ClFNO3
and a molecular weight of 363.82 g/mol. Its IUPAC name is (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid |
| PubChem CID | 70230436 |
| Molecular Formula | C19H19ClFNO3 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid |
| SMILES | CC(C)[C@](C)(C(=O)O)N(C(=O)c1ccccc1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H19ClFNO3/c1-12(2)19(3,18(24)25)22(14-9-10-16(21)15(20)11-14)17(23)13-7-5-4-6-8-13/h4-12H,1-3H3,(H,24,25)/t19-/m1/s1 |
| InChIKey | UJGYMTYDCMVSEM-LJQANCHMSA-N |
| XLogP | 4.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid?
The IUPAC name of (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid (CID 70230436) is (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid.
What is the SMILES notation for (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid?
The canonical SMILES for (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid is CC(C)[C@](C)(C(=O)O)N(C(=O)c1ccccc1)c1ccc(F)c(Cl)c1.
What is the InChIKey of (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid?
The InChIKey is UJGYMTYDCMVSEM-LJQANCHMSA-N. The full InChI is InChI=1S/C19H19ClFNO3/c1-12(2)19(3,18(24)25)22(14-9-10-16(21)15(20)11-14)17(23)13-7-5-4-6-8-13/h4-12H,1-3H3,(H,24,25)/t19-/m1/s1.
What are the key properties of (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid?
(2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid has a molecular weight of 363.82 g/mol, XLogP of 4.63, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(N-benzoyl-3-chloro-4-fluoroanilino)-2,3-dimethylbutanoic acid is sourced from PubChem (CID 70230436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).