About 5-pentyl-2,10-dihydro-1H-phenazine
5-pentyl-2,10-dihydro-1H-phenazine (PubChem CID 70231574) has the molecular formula C17H22N2
and a molecular weight of 254.38 g/mol. Its IUPAC name is 5-pentyl-2,10-dihydro-1H-phenazine.
Molecular Properties
| Compound Name | 5-pentyl-2,10-dihydro-1H-phenazine |
| PubChem CID | 70231574 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 5-pentyl-2,10-dihydro-1H-phenazine |
| SMILES | CCCCCN1C2=C(CCC=C2)Nc2ccccc21 |
| InChI | InChI=1S/C17H22N2/c1-2-3-8-13-19-16-11-6-4-9-14(16)18-15-10-5-7-12-17(15)19/h4,6-7,9,11-12,18H,2-3,5,8,10,13H2,1H3 |
| InChIKey | MRFVTZOIKGQNPN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-pentyl-2,10-dihydro-1H-phenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pentyl-2,10-dihydro-1H-phenazine?
The IUPAC name of 5-pentyl-2,10-dihydro-1H-phenazine (CID 70231574) is 5-pentyl-2,10-dihydro-1H-phenazine.
What is the SMILES notation for 5-pentyl-2,10-dihydro-1H-phenazine?
The canonical SMILES for 5-pentyl-2,10-dihydro-1H-phenazine is CCCCCN1C2=C(CCC=C2)Nc2ccccc21.
What is the InChIKey of 5-pentyl-2,10-dihydro-1H-phenazine?
The InChIKey is MRFVTZOIKGQNPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2/c1-2-3-8-13-19-16-11-6-4-9-14(16)18-15-10-5-7-12-17(15)19/h4,6-7,9,11-12,18H,2-3,5,8,10,13H2,1H3.
What are the key properties of 5-pentyl-2,10-dihydro-1H-phenazine?
5-pentyl-2,10-dihydro-1H-phenazine has a molecular weight of 254.38 g/mol, XLogP of 4.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pentyl-2,10-dihydro-1H-phenazine is sourced from PubChem (CID 70231574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).