About 5-(methoxymethyl)-2-methyl-1,3-oxathiolane
5-(methoxymethyl)-2-methyl-1,3-oxathiolane (PubChem CID 70231585) has the molecular formula C6H12O2S
and a molecular weight of 148.23 g/mol. Its IUPAC name is 5-(methoxymethyl)-2-methyl-1,3-oxathiolane.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-2-methyl-1,3-oxathiolane |
| PubChem CID | 70231585 |
| Molecular Formula | C6H12O2S |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 5-(methoxymethyl)-2-methyl-1,3-oxathiolane |
| SMILES | COCC1CSC(C)O1 |
| InChI | InChI=1S/C6H12O2S/c1-5-8-6(3-7-2)4-9-5/h5-6H,3-4H2,1-2H3 |
| InChIKey | IQAVGUODEFOKPL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(methoxymethyl)-2-methyl-1,3-oxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-2-methyl-1,3-oxathiolane?
The IUPAC name of 5-(methoxymethyl)-2-methyl-1,3-oxathiolane (CID 70231585) is 5-(methoxymethyl)-2-methyl-1,3-oxathiolane.
What is the SMILES notation for 5-(methoxymethyl)-2-methyl-1,3-oxathiolane?
The canonical SMILES for 5-(methoxymethyl)-2-methyl-1,3-oxathiolane is COCC1CSC(C)O1.
What is the InChIKey of 5-(methoxymethyl)-2-methyl-1,3-oxathiolane?
The InChIKey is IQAVGUODEFOKPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2S/c1-5-8-6(3-7-2)4-9-5/h5-6H,3-4H2,1-2H3.
What are the key properties of 5-(methoxymethyl)-2-methyl-1,3-oxathiolane?
5-(methoxymethyl)-2-methyl-1,3-oxathiolane has a molecular weight of 148.23 g/mol, XLogP of 1.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-2-methyl-1,3-oxathiolane is sourced from PubChem (CID 70231585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).