About 1,6-dibromonaphthalen-2-ol;sulfur dioxide
1,6-dibromonaphthalen-2-ol;sulfur dioxide (PubChem CID 70231756) has the molecular formula C10H6Br2O3S
and a molecular weight of 366.03 g/mol. Its IUPAC name is 1,6-dibromonaphthalen-2-ol;sulfur dioxide.
Molecular Properties
| Compound Name | 1,6-dibromonaphthalen-2-ol;sulfur dioxide |
| PubChem CID | 70231756 |
| Molecular Formula | C10H6Br2O3S |
| Molecular Weight | 366.03 g/mol |
| Exact Mass | 363.84 |
| IUPAC Name | 1,6-dibromonaphthalen-2-ol;sulfur dioxide |
| SMILES | O=S=O.Oc1ccc2cc(Br)ccc2c1Br |
| InChI | InChI=1S/C10H6Br2O.O2S/c11-7-2-3-8-6(5-7)1-4-9(13)10(8)12;1-3-2/h1-5,13H; |
| InChIKey | YFXWGMHWCTZJQF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.03 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,6-dibromonaphthalen-2-ol;sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dibromonaphthalen-2-ol;sulfur dioxide?
The IUPAC name of 1,6-dibromonaphthalen-2-ol;sulfur dioxide (CID 70231756) is 1,6-dibromonaphthalen-2-ol;sulfur dioxide.
What is the SMILES notation for 1,6-dibromonaphthalen-2-ol;sulfur dioxide?
The canonical SMILES for 1,6-dibromonaphthalen-2-ol;sulfur dioxide is O=S=O.Oc1ccc2cc(Br)ccc2c1Br.
What is the InChIKey of 1,6-dibromonaphthalen-2-ol;sulfur dioxide?
The InChIKey is YFXWGMHWCTZJQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Br2O.O2S/c11-7-2-3-8-6(5-7)1-4-9(13)10(8)12;1-3-2/h1-5,13H;.
What are the key properties of 1,6-dibromonaphthalen-2-ol;sulfur dioxide?
1,6-dibromonaphthalen-2-ol;sulfur dioxide has a molecular weight of 366.03 g/mol, XLogP of 3.40, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dibromonaphthalen-2-ol;sulfur dioxide is sourced from PubChem (CID 70231756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).