C21H22F5NO — CID 70231837
1,3,5,5-tetrafluoro-6-(6-fluoro-5-hexyl-2-pyridinyl)-7,8-dihydro-6H-naphthalen-2-ol (PubChem CID 70231837) has the molecular formula C21H22F5NO and a molecular weight of 399.40 g/mol. Its IUPAC name is 1,3,5,5-tetrafluoro-6-(6-fluoro-5-hexyl-2-pyridinyl)-7,8-dihydro-6H-naphthalen-2-ol.
| Compound Name | 1,3,5,5-tetrafluoro-6-(6-fluoro-5-hexyl-2-pyridinyl)-7,8-dihydro-6H-naphthalen-2-ol |
|---|---|
| PubChem CID | 70231837 |
| Molecular Formula | C21H22F5NO |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 1,3,5,5-tetrafluoro-6-(6-fluoro-5-hexyl-2-pyridinyl)-7,8-dihydro-6H-naphthalen-2-ol |
| SMILES | CCCCCCc1ccc(C2CCc3c(cc(F)c(O)c3F)C2(F)F)nc1F |
| InChI | InChI=1S/C21H22F5NO/c1-2-3-4-5-6-12-7-10-17(27-20(12)24)14-9-8-13-15(21(14,25)26)11-16(22)19(28)18(13)23/h7,10-11,14,28H,2-6,8-9H2,1H3 |
| InChIKey | AXNRYXLEGOKACX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|