C16H12FN3O5 — CID 70232443
(5S)-5-(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)-5-(furan-2-yl)imidazolidine-2,4-dione (PubChem CID 70232443) has the molecular formula C16H12FN3O5 and a molecular weight of 345.29 g/mol. Its IUPAC name is (5S)-5-(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)-5-(furan-2-yl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)-5-(furan-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70232443 |
| Molecular Formula | C16H12FN3O5 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | (5S)-5-(4-fluoro-5-methoxy-3-oxo-1H-isoindol-2-yl)-5-(furan-2-yl)imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1F)C(=O)N([C@]1(c3ccco3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C16H12FN3O5/c1-24-9-5-4-8-7-20(13(21)11(8)12(9)17)16(10-3-2-6-25-10)14(22)18-15(23)19-16/h2-6H,7H2,1H3,(H2,18,19,22,23)/t16-/m0/s1 |
| InChIKey | RWQKCQVOLHBYRR-INIZCTEOSA-N |
| XLogP | 1.08 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|