C18H33ClN2O2 — CID 70232746
(1S,2R)-8-methoxy-N,1-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine;O-methylhydroxylamine;hydrochloride (PubChem CID 70232746) has the molecular formula C18H33ClN2O2 and a molecular weight of 344.93 g/mol. Its IUPAC name is (1S,2R)-8-methoxy-N,1-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine;O-methylhydroxylamine;hydrochloride.
| Compound Name | (1S,2R)-8-methoxy-N,1-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine;O-methylhydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 70232746 |
| Molecular Formula | C18H33ClN2O2 |
| Molecular Weight | 344.93 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (1S,2R)-8-methoxy-N,1-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine;O-methylhydroxylamine;hydrochloride |
| SMILES | CCCN[C@@H]1CCc2cccc(OC)c2[C@@H]1CCC.CON.Cl |
| InChI | InChI=1S/C17H27NO.CH5NO.ClH/c1-4-7-14-15(18-12-5-2)11-10-13-8-6-9-16(19-3)17(13)14;1-3-2;/h6,8-9,14-15,18H,4-5,7,10-12H2,1-3H3;2H2,1H3;1H/t14-,15-;;/m1../s1 |
| InChIKey | QWRFSHHYCRSMLG-FXUMYAARSA-N |
| XLogP | 3.82 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.93 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|