C20H16F5N3O2S — CID 70233145
11,11-difluoro-9-(methyliminomethyl)-12-[4-(trifluoromethyl)phenyl]sulfonyl-12-azatricyclo[6.3.1.02,7]dodeca-2,4,6,9-tetraen-10-amine (PubChem CID 70233145) has the molecular formula C20H16F5N3O2S and a molecular weight of 457.42 g/mol. Its IUPAC name is 11,11-difluoro-9-(methyliminomethyl)-12-[4-(trifluoromethyl)phenyl]sulfonyl-12-azatricyclo[6.3.1.02,7]dodeca-2,4,6,9-tetraen-10-amine.
| Compound Name | 11,11-difluoro-9-(methyliminomethyl)-12-[4-(trifluoromethyl)phenyl]sulfonyl-12-azatricyclo[6.3.1.02,7]dodeca-2,4,6,9-tetraen-10-amine |
|---|---|
| PubChem CID | 70233145 |
| Molecular Formula | C20H16F5N3O2S |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 11,11-difluoro-9-(methyliminomethyl)-12-[4-(trifluoromethyl)phenyl]sulfonyl-12-azatricyclo[6.3.1.02,7]dodeca-2,4,6,9-tetraen-10-amine |
| SMILES | C/N=C/C1=C(N)C(F)(F)C2c3ccccc3C1N2S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F5N3O2S/c1-27-10-15-16-13-4-2-3-5-14(13)18(19(21,22)17(15)26)28(16)31(29,30)12-8-6-11(7-9-12)20(23,24)25/h2-10,16,18H,26H2,1H3/b27-10+ |
| InChIKey | DAWOCIGGZJEQNI-YPXUMCKCSA-N |
| XLogP | 4.05 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|