C25H27FN4O2 — CID 70233545
5-[(E)-[4-(4-fluorophenyl)-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepin-10-ylidene]methyl]-2-(4-methyl-4,5-dihydroimidazol-1-yl)phenol (PubChem CID 70233545) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is 5-[(E)-[4-(4-fluorophenyl)-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepin-10-ylidene]methyl]-2-(4-methyl-4,5-dihydroimidazol-1-yl)phenol.
| Compound Name | 5-[(E)-[4-(4-fluorophenyl)-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepin-10-ylidene]methyl]-2-(4-methyl-4,5-dihydroimidazol-1-yl)phenol |
|---|---|
| PubChem CID | 70233545 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 5-[(E)-[4-(4-fluorophenyl)-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepin-10-ylidene]methyl]-2-(4-methyl-4,5-dihydroimidazol-1-yl)phenol |
| SMILES | CC1CN(c2ccc(/C=C3\CCCN4CC(c5ccc(F)cc5)CON=C34)cc2O)C=N1 |
| InChI | InChI=1S/C25H27FN4O2/c1-17-13-30(16-27-17)23-9-4-18(12-24(23)31)11-20-3-2-10-29-14-21(15-32-28-25(20)29)19-5-7-22(26)8-6-19/h4-9,11-12,16-17,21,31H,2-3,10,13-15H2,1H3/b20-11+ |
| InChIKey | QHTHTFYESYPAIB-RGVLZGJSSA-N |
| XLogP | 4.37 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |