C44H78N4O8 — CID 70233587
2-[1-oxo-3,4-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)oxybutan-2-yl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylpropanedioic acid (PubChem CID 70233587) has the molecular formula C44H78N4O8 and a molecular weight of 791.13 g/mol. Its IUPAC name is 2-[1-oxo-3,4-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)oxybutan-2-yl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylpropanedioic acid.
| Compound Name | 2-[1-oxo-3,4-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)oxybutan-2-yl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylpropanedioic acid |
|---|---|
| PubChem CID | 70233587 |
| Molecular Formula | C44H78N4O8 |
| Molecular Weight | 791.13 g/mol |
| Exact Mass | 790.58 |
| IUPAC Name | 2-[1-oxo-3,4-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)oxybutan-2-yl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylpropanedioic acid |
| SMILES | CC1(C)CC(CC(C2CC(C)(C)NC(C)(C)C2)C(C(=O)OC2CC(C)(C)NC(C)(C)C2)C(C(=O)O)(C(=O)O)C(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C44H78N4O8/c1-36(2)18-26(19-37(3,4)45-36)17-30(27-20-38(5,6)46-39(7,8)21-27)31(32(49)55-28-22-40(9,10)47-41(11,12)23-28)44(33(50)51,34(52)53)35(54)56-29-24-42(13,14)48-43(15,16)25-29/h26-31,45-48H,17-25H2,1-16H3,(H,50,51)(H,52,53) |
| InChIKey | XFXZVHBGFYSIHD-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 175.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.13 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|