About 5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine
5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine (PubChem CID 70233685) has the molecular formula C17H18FN5S
and a molecular weight of 343.43 g/mol. Its IUPAC name is 5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine.
Molecular Properties
| Compound Name | 5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine |
| PubChem CID | 70233685 |
| Molecular Formula | C17H18FN5S |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine |
| SMILES | NC1=NC2(CCN(C=Nc3cccs3)CC2)Nc2cccc(F)c21 |
| InChI | InChI=1S/C17H18FN5S/c18-12-3-1-4-13-15(12)16(19)22-17(21-13)6-8-23(9-7-17)11-20-14-5-2-10-24-14/h1-5,10-11,21H,6-9H2,(H2,19,22) |
| InChIKey | BFDAIAGGTOZVEA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine?
The IUPAC name of 5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine (CID 70233685) is 5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine.
What is the SMILES notation for 5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine?
The canonical SMILES for 5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine is NC1=NC2(CCN(C=Nc3cccs3)CC2)Nc2cccc(F)c21.
What is the InChIKey of 5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine?
The InChIKey is BFDAIAGGTOZVEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN5S/c18-12-3-1-4-13-15(12)16(19)22-17(21-13)6-8-23(9-7-17)11-20-14-5-2-10-24-14/h1-5,10-11,21H,6-9H2,(H2,19,22).
What are the key properties of 5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine?
5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine has a molecular weight of 343.43 g/mol, XLogP of 3.17, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1'-(thiophen-2-yliminomethyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine is sourced from PubChem (CID 70233685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).