C13H9N5O3 — CID 70234478
(5S)-5-[5-(1H-1,2,4-triazol-5-yl)-1-benzofuran-2-yl]imidazolidine-2,4-dione (PubChem CID 70234478) has the molecular formula C13H9N5O3 and a molecular weight of 283.25 g/mol. Its IUPAC name is (5S)-5-[5-(1H-1,2,4-triazol-5-yl)-1-benzofuran-2-yl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[5-(1H-1,2,4-triazol-5-yl)-1-benzofuran-2-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70234478 |
| Molecular Formula | C13H9N5O3 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | (5S)-5-[5-(1H-1,2,4-triazol-5-yl)-1-benzofuran-2-yl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@H](c2cc3cc(-c4ncn[nH]4)ccc3o2)N1 |
| InChI | InChI=1S/C13H9N5O3/c19-12-10(16-13(20)17-12)9-4-7-3-6(1-2-8(7)21-9)11-14-5-15-18-11/h1-5,10H,(H,14,15,18)(H2,16,17,19,20)/t10-/m0/s1 |
| InChIKey | CGEIYRYGMJMHEJ-JTQLQIEISA-N |
| XLogP | 1.10 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|