C15H28N4O3+2 — CID 7023460
2-[[(5R)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneazaniumyl]ethyl-diethylazanium (PubChem CID 7023460) has the molecular formula C15H28N4O3+2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[[(5R)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneazaniumyl]ethyl-diethylazanium.
| Compound Name | 2-[[(5R)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneazaniumyl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7023460 |
| Molecular Formula | C15H28N4O3+2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 2-[[(5R)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneazaniumyl]ethyl-diethylazanium |
| SMILES | CCCCN1C(=O)NC(=O)[C@@H](/C=[NH+]/CC[NH+](CC)CC)C1=O |
| InChI | InChI=1S/C15H26N4O3/c1-4-7-9-19-14(21)12(13(20)17-15(19)22)11-16-8-10-18(5-2)6-3/h11-12H,4-10H2,1-3H3,(H,17,20,22)/p+2/b16-11+/t12-/m1/s1 |
| InChIKey | UWPVCISCLPMCHM-PILJQMSFSA-P |
| XLogP | -2.44 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|