C16H23F3N2O5 — CID 70234649
(3S)-4-(1-adamantylamino)-3-amino-4-oxobutanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 70234649) has the molecular formula C16H23F3N2O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is (3S)-4-(1-adamantylamino)-3-amino-4-oxobutanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (3S)-4-(1-adamantylamino)-3-amino-4-oxobutanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70234649 |
| Molecular Formula | C16H23F3N2O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (3S)-4-(1-adamantylamino)-3-amino-4-oxobutanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)NC12CC3CC(CC(C3)C1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N2O3.C2HF3O2/c15-11(4-12(17)18)13(19)16-14-5-8-1-9(6-14)3-10(2-8)7-14;3-2(4,5)1(6)7/h8-11H,1-7,15H2,(H,16,19)(H,17,18);(H,6,7)/t8?,9?,10?,11-,14?;/m0./s1 |
| InChIKey | YIWCHRCEHVPHPV-FOAZZYOESA-N |
| XLogP | 1.51 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |