C21H23FN6O3 — CID 70234864
N-[3-(2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl)-4-fluorophenyl]-5-but-3-enoxypyrazine-2-carboxamide (PubChem CID 70234864) has the molecular formula C21H23FN6O3 and a molecular weight of 426.45 g/mol. Its IUPAC name is N-[3-(2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl)-4-fluorophenyl]-5-but-3-enoxypyrazine-2-carboxamide.
| Compound Name | N-[3-(2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl)-4-fluorophenyl]-5-but-3-enoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 70234864 |
| Molecular Formula | C21H23FN6O3 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N-[3-(2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl)-4-fluorophenyl]-5-but-3-enoxypyrazine-2-carboxamide |
| SMILES | C=CCCOc1cnc(C(=O)Nc2ccc(F)c(C3(C)CC(=O)N(C)C(N)=N3)c2)cn1 |
| InChI | InChI=1S/C21H23FN6O3/c1-4-5-8-31-17-12-24-16(11-25-17)19(30)26-13-6-7-15(22)14(9-13)21(2)10-18(29)28(3)20(23)27-21/h4,6-7,9,11-12H,1,5,8,10H2,2-3H3,(H2,23,27)(H,26,30) |
| InChIKey | QKHUKXPPEPQRCN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|