C23H25NO7 — CID 70234900
2-[(2R,10S,12R)-10-(2,3-dimethoxyphenyl)-2,7-dimethyl-13-oxo-4,11-dioxa-1-azatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-trien-12-yl]acetic acid (PubChem CID 70234900) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-[(2R,10S,12R)-10-(2,3-dimethoxyphenyl)-2,7-dimethyl-13-oxo-4,11-dioxa-1-azatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-trien-12-yl]acetic acid.
| Compound Name | 2-[(2R,10S,12R)-10-(2,3-dimethoxyphenyl)-2,7-dimethyl-13-oxo-4,11-dioxa-1-azatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-trien-12-yl]acetic acid |
|---|---|
| PubChem CID | 70234900 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-[(2R,10S,12R)-10-(2,3-dimethoxyphenyl)-2,7-dimethyl-13-oxo-4,11-dioxa-1-azatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-trien-12-yl]acetic acid |
| SMILES | COc1cccc([C@H]2O[C@H](CC(=O)O)C(=O)N3c4c(cc(C)cc42)OC[C@H]3C)c1OC |
| InChI | InChI=1S/C23H25NO7/c1-12-8-15-20-17(9-12)30-11-13(2)24(20)23(27)18(10-19(25)26)31-21(15)14-6-5-7-16(28-3)22(14)29-4/h5-9,13,18,21H,10-11H2,1-4H3,(H,25,26)/t13-,18-,21-/m1/s1 |
| InChIKey | LAZUDMGWRBLECD-XMLVGPMBSA-N |
| XLogP | 3.09 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |