About 5-methyl-2-pentyl-1,2-dihydropyrazine
5-methyl-2-pentyl-1,2-dihydropyrazine (PubChem CID 70235099) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 5-methyl-2-pentyl-1,2-dihydropyrazine.
Molecular Properties
| Compound Name | 5-methyl-2-pentyl-1,2-dihydropyrazine |
| PubChem CID | 70235099 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 5-methyl-2-pentyl-1,2-dihydropyrazine |
| SMILES | CCCCCC1C=NC(C)=CN1 |
| InChI | InChI=1S/C10H18N2/c1-3-4-5-6-10-8-11-9(2)7-12-10/h7-8,10,12H,3-6H2,1-2H3 |
| InChIKey | BLCRTTISXUXPPX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-pentyl-1,2-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-pentyl-1,2-dihydropyrazine?
The IUPAC name of 5-methyl-2-pentyl-1,2-dihydropyrazine (CID 70235099) is 5-methyl-2-pentyl-1,2-dihydropyrazine.
What is the SMILES notation for 5-methyl-2-pentyl-1,2-dihydropyrazine?
The canonical SMILES for 5-methyl-2-pentyl-1,2-dihydropyrazine is CCCCCC1C=NC(C)=CN1.
What is the InChIKey of 5-methyl-2-pentyl-1,2-dihydropyrazine?
The InChIKey is BLCRTTISXUXPPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-3-4-5-6-10-8-11-9(2)7-12-10/h7-8,10,12H,3-6H2,1-2H3.
What are the key properties of 5-methyl-2-pentyl-1,2-dihydropyrazine?
5-methyl-2-pentyl-1,2-dihydropyrazine has a molecular weight of 166.27 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-pentyl-1,2-dihydropyrazine is sourced from PubChem (CID 70235099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).