C10H18O5S — CID 70235946
1-(2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-(hydroxymethylsulfanyl)ethanol (PubChem CID 70235946) has the molecular formula C10H18O5S and a molecular weight of 250.32 g/mol. Its IUPAC name is 1-(2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-(hydroxymethylsulfanyl)ethanol.
| Compound Name | 1-(2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-(hydroxymethylsulfanyl)ethanol |
|---|---|
| PubChem CID | 70235946 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 1-(2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-(hydroxymethylsulfanyl)ethanol |
| SMILES | CC1(C)OC2CC(C(O)CSCO)OC2O1 |
| InChI | InChI=1S/C10H18O5S/c1-10(2)14-8-3-7(13-9(8)15-10)6(12)4-16-5-11/h6-9,11-12H,3-5H2,1-2H3 |
| InChIKey | WGCGJYDIIDVTDY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|