3H-1,2,5-thiadiazole-2-carboxylic acid

C3H4N2O2S — CID 70236135

IUPAC3H-1,2,5-thiadiazole-2-carboxylic acid
SMILESO=C(O)N1CC=NS1
InChIInChI=1S/C3H4N2O2S/c6-3(7)5-2-1-4-8-5/h1H,2H2,(H,6,7)
InChIKeyFXPQEYMACKZLDJ-UHFFFAOYSA-N
MW132.14 g/mol
LogP0.61
Rot. Bonds

About 3H-1,2,5-thiadiazole-2-carboxylic acid

3H-1,2,5-thiadiazole-2-carboxylic acid (PubChem CID 70236135) has the molecular formula C3H4N2O2S and a molecular weight of 132.14 g/mol. Its IUPAC name is 3H-1,2,5-thiadiazole-2-carboxylic acid.

Molecular Properties

Compound Name3H-1,2,5-thiadiazole-2-carboxylic acid
PubChem CID70236135
Molecular FormulaC3H4N2O2S
Molecular Weight132.14 g/mol
Exact Mass132.00
IUPAC Name3H-1,2,5-thiadiazole-2-carboxylic acid
SMILESO=C(O)N1CC=NS1
InChIInChI=1S/C3H4N2O2S/c6-3(7)5-2-1-4-8-5/h1H,2H2,(H,6,7)
InChIKeyFXPQEYMACKZLDJ-UHFFFAOYSA-N
XLogP0.61
TPSA52.90 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.14
LogP ≤ 50.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3H-1,2,5-thiadiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3H-1,2,5-thiadiazole-2-carboxylic acid?
The IUPAC name of 3H-1,2,5-thiadiazole-2-carboxylic acid (CID 70236135) is 3H-1,2,5-thiadiazole-2-carboxylic acid.
What is the SMILES notation for 3H-1,2,5-thiadiazole-2-carboxylic acid?
The canonical SMILES for 3H-1,2,5-thiadiazole-2-carboxylic acid is O=C(O)N1CC=NS1.
What is the InChIKey of 3H-1,2,5-thiadiazole-2-carboxylic acid?
The InChIKey is FXPQEYMACKZLDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2S/c6-3(7)5-2-1-4-8-5/h1H,2H2,(H,6,7).
What are the key properties of 3H-1,2,5-thiadiazole-2-carboxylic acid?
3H-1,2,5-thiadiazole-2-carboxylic acid has a molecular weight of 132.14 g/mol, XLogP of 0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,2,5-thiadiazole-2-carboxylic acid is sourced from PubChem (CID 70236135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).