About 3H-1,2,5-thiadiazole-2-carboxylic acid
3H-1,2,5-thiadiazole-2-carboxylic acid (PubChem CID 70236135) has the molecular formula C3H4N2O2S
and a molecular weight of 132.14 g/mol. Its IUPAC name is 3H-1,2,5-thiadiazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3H-1,2,5-thiadiazole-2-carboxylic acid |
| PubChem CID | 70236135 |
| Molecular Formula | C3H4N2O2S |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 132.00 |
| IUPAC Name | 3H-1,2,5-thiadiazole-2-carboxylic acid |
| SMILES | O=C(O)N1CC=NS1 |
| InChI | InChI=1S/C3H4N2O2S/c6-3(7)5-2-1-4-8-5/h1H,2H2,(H,6,7) |
| InChIKey | FXPQEYMACKZLDJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3H-1,2,5-thiadiazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,2,5-thiadiazole-2-carboxylic acid?
The IUPAC name of 3H-1,2,5-thiadiazole-2-carboxylic acid (CID 70236135) is 3H-1,2,5-thiadiazole-2-carboxylic acid.
What is the SMILES notation for 3H-1,2,5-thiadiazole-2-carboxylic acid?
The canonical SMILES for 3H-1,2,5-thiadiazole-2-carboxylic acid is O=C(O)N1CC=NS1.
What is the InChIKey of 3H-1,2,5-thiadiazole-2-carboxylic acid?
The InChIKey is FXPQEYMACKZLDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2S/c6-3(7)5-2-1-4-8-5/h1H,2H2,(H,6,7).
What are the key properties of 3H-1,2,5-thiadiazole-2-carboxylic acid?
3H-1,2,5-thiadiazole-2-carboxylic acid has a molecular weight of 132.14 g/mol, XLogP of 0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,2,5-thiadiazole-2-carboxylic acid is sourced from PubChem (CID 70236135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).