About 2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline
2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline (PubChem CID 70236350) has the molecular formula C18H24N2O4
and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline.
Molecular Properties
| Compound Name | 2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline |
| PubChem CID | 70236350 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline |
| SMILES | CCOC1CCC(Oc2cnc3cc(OC)c(OC)cc3n2)CC1 |
| InChI | InChI=1S/C18H24N2O4/c1-4-23-12-5-7-13(8-6-12)24-18-11-19-14-9-16(21-2)17(22-3)10-15(14)20-18/h9-13H,4-8H2,1-3H3 |
| InChIKey | PIHKLBXFLJPQMZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline?
The IUPAC name of 2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline (CID 70236350) is 2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline.
What is the SMILES notation for 2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline?
The canonical SMILES for 2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline is CCOC1CCC(Oc2cnc3cc(OC)c(OC)cc3n2)CC1.
What is the InChIKey of 2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline?
The InChIKey is PIHKLBXFLJPQMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O4/c1-4-23-12-5-7-13(8-6-12)24-18-11-19-14-9-16(21-2)17(22-3)10-15(14)20-18/h9-13H,4-8H2,1-3H3.
What are the key properties of 2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline?
2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline has a molecular weight of 332.40 g/mol, XLogP of 3.37, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxycyclohexyl)oxy-6,7-dimethoxyquinoxaline is sourced from PubChem (CID 70236350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).