About (4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate
(4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate (PubChem CID 70236423) has the molecular formula C16H14FNO2
and a molecular weight of 271.29 g/mol. Its IUPAC name is (4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate.
Molecular Properties
| Compound Name | (4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate |
| PubChem CID | 70236423 |
| Molecular Formula | C16H14FNO2 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OC2=CCC(F)(C#N)C=C2)cc1 |
| InChI | InChI=1S/C16H14FNO2/c1-2-12-3-5-13(6-4-12)15(19)20-14-7-9-16(17,11-18)10-8-14/h3-9H,2,10H2,1H3 |
| InChIKey | PZONMMUSHVZWME-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate?
The IUPAC name of (4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate (CID 70236423) is (4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate.
What is the SMILES notation for (4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate?
The canonical SMILES for (4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate is CCc1ccc(C(=O)OC2=CCC(F)(C#N)C=C2)cc1.
What is the InChIKey of (4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate?
The InChIKey is PZONMMUSHVZWME-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO2/c1-2-12-3-5-13(6-4-12)15(19)20-14-7-9-16(17,11-18)10-8-14/h3-9H,2,10H2,1H3.
What are the key properties of (4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate?
(4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate has a molecular weight of 271.29 g/mol, XLogP of 3.48, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyano-4-fluorocyclohexa-1,5-dien-1-yl) 4-ethylbenzoate is sourced from PubChem (CID 70236423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).