C13H20N4 — CID 70236898
(10E)-2,10-dimethyl-3,6,9,12-tetrazabicyclo[9.3.1]pentadeca-1(15),2,10,12-tetraene (PubChem CID 70236898) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is (10E)-2,10-dimethyl-3,6,9,12-tetrazabicyclo[9.3.1]pentadeca-1(15),2,10,12-tetraene.
| Compound Name | (10E)-2,10-dimethyl-3,6,9,12-tetrazabicyclo[9.3.1]pentadeca-1(15),2,10,12-tetraene |
|---|---|
| PubChem CID | 70236898 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (10E)-2,10-dimethyl-3,6,9,12-tetrazabicyclo[9.3.1]pentadeca-1(15),2,10,12-tetraene |
| SMILES | C/C1=N/CCNCCN/C(C)=C2\C=C1CC=N2 |
| InChI | InChI=1S/C13H20N4/c1-10-12-3-4-17-13(9-12)11(2)16-8-6-14-5-7-15-10/h4,9,14,16H,3,5-8H2,1-2H3/b13-11+,15-10- |
| InChIKey | CSBFOJHEOLETPU-OPLAHFIWSA-N |
| XLogP | 1.27 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |