C21H34O7 — CID 70237325
methyl 2-[(2S,6R,7S,8R,8aR)-7-(2-methoxyethoxymethoxy)-6,8,8a-trimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate (PubChem CID 70237325) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is methyl 2-[(2S,6R,7S,8R,8aR)-7-(2-methoxyethoxymethoxy)-6,8,8a-trimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate.
| Compound Name | methyl 2-[(2S,6R,7S,8R,8aR)-7-(2-methoxyethoxymethoxy)-6,8,8a-trimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 70237325 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | methyl 2-[(2S,6R,7S,8R,8aR)-7-(2-methoxyethoxymethoxy)-6,8,8a-trimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl]-2-hydroxypropanoate |
| SMILES | COCCOCO[C@H]1[C@H](C)CC2=CC(=O)[C@H](C(C)(O)C(=O)OC)C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C21H34O7/c1-13-9-15-10-17(22)16(21(4,24)19(23)26-6)11-20(15,3)14(2)18(13)28-12-27-8-7-25-5/h10,13-14,16,18,24H,7-9,11-12H2,1-6H3/t13-,14+,16-,18+,20-,21?/m1/s1 |
| InChIKey | IBFBYDFYCSIYTE-BYJJCBAXSA-N |
| XLogP | 2.11 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|