C20H26O6 — CID 70237381
[(4aR,5R,6R,7S)-6-(methoxymethoxy)-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-7-yl] propanoate (PubChem CID 70237381) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is [(4aR,5R,6R,7S)-6-(methoxymethoxy)-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-7-yl] propanoate.
| Compound Name | [(4aR,5R,6R,7S)-6-(methoxymethoxy)-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-7-yl] propanoate |
|---|---|
| PubChem CID | 70237381 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(4aR,5R,6R,7S)-6-(methoxymethoxy)-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-7-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1C=C2C=C3OC(=O)C(C)=C3C[C@]2(C)[C@@H](C)[C@H]1OCOC |
| InChI | InChI=1S/C20H26O6/c1-6-17(21)25-16-8-13-7-15-14(11(2)19(22)26-15)9-20(13,4)12(3)18(16)24-10-23-5/h7-8,12,16,18H,6,9-10H2,1-5H3/t12-,16-,18+,20+/m0/s1 |
| InChIKey | WHCGTLARMRUWPD-ALGDJNJFSA-N |
| XLogP | 3.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|