C14H20O3 — CID 70237443
(1'R,8'aR)-1',8'a-dimethylspiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-1H-naphthalene]-2'-one (PubChem CID 70237443) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1'R,8'aR)-1',8'a-dimethylspiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-1H-naphthalene]-2'-one.
| Compound Name | (1'R,8'aR)-1',8'a-dimethylspiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-1H-naphthalene]-2'-one |
|---|---|
| PubChem CID | 70237443 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1'R,8'aR)-1',8'a-dimethylspiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-1H-naphthalene]-2'-one |
| SMILES | C[C@H]1C(=O)CCC2=CC3(CC[C@@]21C)OCCO3 |
| InChI | InChI=1S/C14H20O3/c1-10-12(15)4-3-11-9-14(16-7-8-17-14)6-5-13(10,11)2/h9-10H,3-8H2,1-2H3/t10-,13+/m0/s1 |
| InChIKey | KQGHLFHAMYCNEI-GXFFZTMASA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|