C21H22O5 — CID 70237490
[(4aR,5R,6S)-3,4a,5,9-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] furan-2-carboxylate (PubChem CID 70237490) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is [(4aR,5R,6S)-3,4a,5,9-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] furan-2-carboxylate.
| Compound Name | [(4aR,5R,6S)-3,4a,5,9-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 70237490 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [(4aR,5R,6S)-3,4a,5,9-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] furan-2-carboxylate |
| SMILES | CC1=C2C[C@@]3(C)C(=CC[C@H](OC(=O)c4ccco4)[C@@H]3C)C(C)=C2OC1=O |
| InChI | InChI=1S/C21H22O5/c1-11-14-10-21(4)13(3)16(25-20(23)17-6-5-9-24-17)8-7-15(21)12(2)18(14)26-19(11)22/h5-7,9,13,16H,8,10H2,1-4H3/t13-,16-,21+/m0/s1 |
| InChIKey | NBBAPEKZXDEKRJ-UYTHQXMGSA-N |
| XLogP | 4.33 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |