C25H29F3N4O3 — CID 70237675
6'-[3-amino-5-(trifluoromethyl)phenyl]-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine (PubChem CID 70237675) has the molecular formula C25H29F3N4O3 and a molecular weight of 490.53 g/mol. Its IUPAC name is 6'-[3-amino-5-(trifluoromethyl)phenyl]-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine.
| Compound Name | 6'-[3-amino-5-(trifluoromethyl)phenyl]-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
|---|---|
| PubChem CID | 70237675 |
| Molecular Formula | C25H29F3N4O3 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 6'-[3-amino-5-(trifluoromethyl)phenyl]-2'-(2,2-dimethyloxan-4-yl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
| SMILES | CN1OC2(CC(C3CCOC(C)(C)C3)Oc3ccc(-c4cc(N)cc(C(F)(F)F)c4)cc32)N=C1N |
| InChI | InChI=1S/C25H29F3N4O3/c1-23(2)12-15(6-7-33-23)21-13-24(31-22(30)32(3)35-24)19-10-14(4-5-20(19)34-21)16-8-17(25(26,27)28)11-18(29)9-16/h4-5,8-11,15,21H,6-7,12-13,29H2,1-3H3,(H2,30,31) |
| InChIKey | XGKAIBFJPNXFLJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|