C27H35Cl2N3O3 — CID 70237787
(2R,3S,4R,5S)-4-amino-3-(3-chlorophenyl)-4-(4-chlorophenyl)-5-cyclohexyl-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide (PubChem CID 70237787) has the molecular formula C27H35Cl2N3O3 and a molecular weight of 520.50 g/mol. Its IUPAC name is (2R,3S,4R,5S)-4-amino-3-(3-chlorophenyl)-4-(4-chlorophenyl)-5-cyclohexyl-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-4-amino-3-(3-chlorophenyl)-4-(4-chlorophenyl)-5-cyclohexyl-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70237787 |
| Molecular Formula | C27H35Cl2N3O3 |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | (2R,3S,4R,5S)-4-amino-3-(3-chlorophenyl)-4-(4-chlorophenyl)-5-cyclohexyl-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide |
| SMILES | N[C@]1(c2ccc(Cl)cc2)[C@H](C2CCCCC2)N[C@@H](C(=O)NCC[C@H](O)CO)[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H35Cl2N3O3/c28-20-11-9-19(10-12-20)27(30)23(18-7-4-8-21(29)15-18)24(26(35)31-14-13-22(34)16-33)32-25(27)17-5-2-1-3-6-17/h4,7-12,15,17,22-25,32-34H,1-3,5-6,13-14,16,30H2,(H,31,35)/t22-,23-,24+,25-,27-/m0/s1 |
| InChIKey | YAVWTGVIZZYECV-DKLFHUDLSA-N |
| XLogP | 3.71 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |