About N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid
N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid (PubChem CID 70237798) has the molecular formula C16H20N2O4
and a molecular weight of 304.35 g/mol. Its IUPAC name is N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid.
Molecular Properties
| Compound Name | N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid |
| PubChem CID | 70237798 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid |
| SMILES | CCC(C)C(=O)NCO.O=C(O)c1ccc2cccnc2c1 |
| InChI | InChI=1S/C10H7NO2.C6H13NO2/c12-10(13)8-4-3-7-2-1-5-11-9(7)6-8;1-3-5(2)6(9)7-4-8/h1-6H,(H,12,13);5,8H,3-4H2,1-2H3,(H,7,9) |
| InChIKey | OOHIAOMQSHSHFB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid?
The IUPAC name of N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid (CID 70237798) is N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid.
What is the SMILES notation for N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid?
The canonical SMILES for N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid is CCC(C)C(=O)NCO.O=C(O)c1ccc2cccnc2c1.
What is the InChIKey of N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid?
The InChIKey is OOHIAOMQSHSHFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2.C6H13NO2/c12-10(13)8-4-3-7-2-1-5-11-9(7)6-8;1-3-5(2)6(9)7-4-8/h1-6H,(H,12,13);5,8H,3-4H2,1-2H3,(H,7,9).
What are the key properties of N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid?
N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid has a molecular weight of 304.35 g/mol, XLogP of 2.03, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(hydroxymethyl)-2-methylbutanamide;quinoline-7-carboxylic acid is sourced from PubChem (CID 70237798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).