C21H32N6O2 — CID 70237982
N-(2-acetamidoethyl)-4-(1-cyclohexylethylamino)-1-ethylpyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 70237982) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4-(1-cyclohexylethylamino)-1-ethylpyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-4-(1-cyclohexylethylamino)-1-ethylpyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 70237982 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | N-(2-acetamidoethyl)-4-(1-cyclohexylethylamino)-1-ethylpyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCn1ncc2c(NC(C)C3CCCCC3)c(C(=O)NCCNC(C)=O)cnc21 |
| InChI | InChI=1S/C21H32N6O2/c1-4-27-20-17(13-25-27)19(26-14(2)16-8-6-5-7-9-16)18(12-24-20)21(29)23-11-10-22-15(3)28/h12-14,16H,4-11H2,1-3H3,(H,22,28)(H,23,29)(H,24,26) |
| InChIKey | SPMQPNMLIOOBGR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|