C9H14F4N2O2 — CID 70238749
1,3-diethyl-2-fluoro-4,5-dihydroimidazol-1-ium;2,2,2-trifluoroacetate (PubChem CID 70238749) has the molecular formula C9H14F4N2O2 and a molecular weight of 258.21 g/mol. Its IUPAC name is 1,3-diethyl-2-fluoro-4,5-dihydroimidazol-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 1,3-diethyl-2-fluoro-4,5-dihydroimidazol-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 70238749 |
| Molecular Formula | C9H14F4N2O2 |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1,3-diethyl-2-fluoro-4,5-dihydroimidazol-1-ium;2,2,2-trifluoroacetate |
| SMILES | CCN1CC[N+](CC)=C1F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C7H14FN2.C2HF3O2/c1-3-9-5-6-10(4-2)7(9)8;3-2(4,5)1(6)7/h3-6H2,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | CIODGUNBFBPKTB-UHFFFAOYSA-M |
| XLogP | -0.02 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|