About 1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one
1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one (PubChem CID 702389) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one.
Molecular Properties
| Compound Name | 1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one |
| PubChem CID | 702389 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one |
| SMILES | CC(=O)N1CCC(=O)N(C(C)C)c2ccccc21 |
| InChI | InChI=1S/C14H18N2O2/c1-10(2)16-13-7-5-4-6-12(13)15(11(3)17)9-8-14(16)18/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | OUAHQRHHSGYRGL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one?
The IUPAC name of 1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one (CID 702389) is 1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one.
What is the SMILES notation for 1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one?
The canonical SMILES for 1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one is CC(=O)N1CCC(=O)N(C(C)C)c2ccccc21.
What is the InChIKey of 1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one?
The InChIKey is OUAHQRHHSGYRGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-10(2)16-13-7-5-4-6-12(13)15(11(3)17)9-8-14(16)18/h4-7,10H,8-9H2,1-3H3.
What are the key properties of 1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one?
1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one has a molecular weight of 246.31 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-5-propan-2-yl-2,3-dihydro-1,5-benzodiazepin-4-one is sourced from PubChem (CID 702389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).