C18H17FNO3+ — CID 70238929
(3S)-3-acetyl-4-benzyl-3-(4-fluorophenyl)-1,3-oxazolidin-3-ium-2-one (PubChem CID 70238929) has the molecular formula C18H17FNO3+ and a molecular weight of 314.34 g/mol. Its IUPAC name is (3S)-3-acetyl-4-benzyl-3-(4-fluorophenyl)-1,3-oxazolidin-3-ium-2-one.
| Compound Name | (3S)-3-acetyl-4-benzyl-3-(4-fluorophenyl)-1,3-oxazolidin-3-ium-2-one |
|---|---|
| PubChem CID | 70238929 |
| Molecular Formula | C18H17FNO3+ |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (3S)-3-acetyl-4-benzyl-3-(4-fluorophenyl)-1,3-oxazolidin-3-ium-2-one |
| SMILES | CC(=O)[N@+]1(c2ccc(F)cc2)C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C18H17FNO3/c1-13(21)20(16-9-7-15(19)8-10-16)17(12-23-18(20)22)11-14-5-3-2-4-6-14/h2-10,17H,11-12H2,1H3/q+1/t17?,20-/m1/s1 |
| InChIKey | MVFALYJCMDMAPA-UUSAFJCLSA-N |
| XLogP | 3.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|