C14H20N2 — CID 70239123
(3S)-3-(pyrrolidin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 70239123) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (3S)-3-(pyrrolidin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | (3S)-3-(pyrrolidin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 70239123 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (3S)-3-(pyrrolidin-1-ylmethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc2c(c1)C[C@H](CN1CCCC1)CN2 |
| InChI | InChI=1S/C14H20N2/c1-2-6-14-13(5-1)9-12(10-15-14)11-16-7-3-4-8-16/h1-2,5-6,12,15H,3-4,7-11H2/t12-/m0/s1 |
| InChIKey | AMENXHWAGARJMJ-LBPRGKRZSA-N |
| XLogP | 2.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |