About butane;ethyl piperidine-1-carboxylate
butane;ethyl piperidine-1-carboxylate (PubChem CID 70239415) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is butane;ethyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | butane;ethyl piperidine-1-carboxylate |
| PubChem CID | 70239415 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | butane;ethyl piperidine-1-carboxylate |
| SMILES | CCCC.CCOC(=O)N1CCCCC1 |
| InChI | InChI=1S/C8H15NO2.C4H10/c1-2-11-8(10)9-6-4-3-5-7-9;1-3-4-2/h2-7H2,1H3;3-4H2,1-2H3 |
| InChIKey | OIAXNQDWDOWODP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;ethyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethyl piperidine-1-carboxylate?
The IUPAC name of butane;ethyl piperidine-1-carboxylate (CID 70239415) is butane;ethyl piperidine-1-carboxylate.
What is the SMILES notation for butane;ethyl piperidine-1-carboxylate?
The canonical SMILES for butane;ethyl piperidine-1-carboxylate is CCCC.CCOC(=O)N1CCCCC1.
What is the InChIKey of butane;ethyl piperidine-1-carboxylate?
The InChIKey is OIAXNQDWDOWODP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C4H10/c1-2-11-8(10)9-6-4-3-5-7-9;1-3-4-2/h2-7H2,1H3;3-4H2,1-2H3.
What are the key properties of butane;ethyl piperidine-1-carboxylate?
butane;ethyl piperidine-1-carboxylate has a molecular weight of 215.34 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethyl piperidine-1-carboxylate is sourced from PubChem (CID 70239415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).