C22H24O5S — CID 70239807
[(4aR,5R,6R,7R)-7-ethoxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] thiophene-2-carboxylate (PubChem CID 70239807) has the molecular formula C22H24O5S and a molecular weight of 400.50 g/mol. Its IUPAC name is [(4aR,5R,6R,7R)-7-ethoxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] thiophene-2-carboxylate.
| Compound Name | [(4aR,5R,6R,7R)-7-ethoxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 70239807 |
| Molecular Formula | C22H24O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [(4aR,5R,6R,7R)-7-ethoxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] thiophene-2-carboxylate |
| SMILES | CCO[C@@H]1C=C2C=C3OC(=O)C(C)=C3C[C@]2(C)[C@@H](C)[C@H]1OC(=O)c1cccs1 |
| InChI | InChI=1S/C22H24O5S/c1-5-25-17-10-14-9-16-15(12(2)20(23)26-16)11-22(14,4)13(3)19(17)27-21(24)18-7-6-8-28-18/h6-10,13,17,19H,5,11H2,1-4H3/t13-,17+,19+,22+/m0/s1 |
| InChIKey | OEJXOHCIJGICOJ-DJYWDEKISA-N |
| XLogP | 4.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |