C16H23NO8 — CID 70239988
(2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-(4-nitrophenoxy)oxane (PubChem CID 70239988) has the molecular formula C16H23NO8 and a molecular weight of 357.36 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-(4-nitrophenoxy)oxane.
| Compound Name | (2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-(4-nitrophenoxy)oxane |
|---|---|
| PubChem CID | 70239988 |
| Molecular Formula | C16H23NO8 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (2R,3S,4S,5R,6R)-3,4,5-trimethoxy-2-(methoxymethyl)-6-(4-nitrophenoxy)oxane |
| SMILES | COC[C@H]1O[C@H](Oc2ccc([N+](=O)[O-])cc2)[C@H](OC)[C@@H](OC)[C@H]1OC |
| InChI | InChI=1S/C16H23NO8/c1-20-9-12-13(21-2)14(22-3)15(23-4)16(25-12)24-11-7-5-10(6-8-11)17(18)19/h5-8,12-16H,9H2,1-4H3/t12-,13+,14+,15-,16+/m1/s1 |
| InChIKey | JBWCYPQQRZZMKJ-CWVYHPPDSA-N |
| XLogP | 1.39 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|